C17H24 — CID 144542700
7,7-dimethyl-5,5a,6,8,9,10,10a,11-octahydrocyclohepta[b]naphthalene (PubChem CID 144542700) has the molecular formula C17H24 and a molecular weight of 228.38 g/mol. Its IUPAC name is 7,7-dimethyl-5,5a,6,8,9,10,10a,11-octahydrocyclohepta[b]naphthalene.
| Compound Name | 7,7-dimethyl-5,5a,6,8,9,10,10a,11-octahydrocyclohepta[b]naphthalene |
|---|---|
| PubChem CID | 144542700 |
| Molecular Formula | C17H24 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 7,7-dimethyl-5,5a,6,8,9,10,10a,11-octahydrocyclohepta[b]naphthalene |
| SMILES | CC1(C)CCCC2Cc3ccccc3CC2C1 |
| InChI | InChI=1S/C17H24/c1-17(2)9-5-8-15-10-13-6-3-4-7-14(13)11-16(15)12-17/h3-4,6-7,15-16H,5,8-12H2,1-2H3 |
| InChIKey | KKDYRXXMYTZCOO-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |