About ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid
ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid (PubChem CID 144542863) has the molecular formula C14H26N2O5
and a molecular weight of 302.37 g/mol. Its IUPAC name is ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid.
Molecular Properties
| Compound Name | ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid |
| PubChem CID | 144542863 |
| Molecular Formula | C14H26N2O5 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid |
| SMILES | C/C=C\C(=C/C)COC(=O)NCCC(N)=O.CC.O=CO |
| InChI | InChI=1S/C11H18N2O3.C2H6.CH2O2/c1-3-5-9(4-2)8-16-11(15)13-7-6-10(12)14;1-2;2-1-3/h3-5H,6-8H2,1-2H3,(H2,12,14)(H,13,15);1-2H3;1H,(H,2,3)/b5-3-,9-4+;; |
| InChIKey | OZDQGUSFCLZZFB-ULOKQNOHSA-N |
| XLogP | 1.84 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid?
The IUPAC name of ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid (CID 144542863) is ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid.
What is the SMILES notation for ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid?
The canonical SMILES for ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid is C/C=C\C(=C/C)COC(=O)NCCC(N)=O.CC.O=CO.
What is the InChIKey of ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid?
The InChIKey is OZDQGUSFCLZZFB-ULOKQNOHSA-N. The full InChI is InChI=1S/C11H18N2O3.C2H6.CH2O2/c1-3-5-9(4-2)8-16-11(15)13-7-6-10(12)14;1-2;2-1-3/h3-5H,6-8H2,1-2H3,(H2,12,14)(H,13,15);1-2H3;1H,(H,2,3)/b5-3-,9-4+;;.
What are the key properties of ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid?
ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid has a molecular weight of 302.37 g/mol, XLogP of 1.84, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(Z,2E)-2-ethylidenepent-3-enyl] N-(3-amino-3-oxopropyl)carbamate;formic acid is sourced from PubChem (CID 144542863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).