C25H20F8N4O3 — CID 144542907
(3S)-N-[5-[3-fluoro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)cyclohepta-1,3,6-trien-1-yl]-1-(4-fluorophenyl)pyrazol-3-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 144542907) has the molecular formula C25H20F8N4O3 and a molecular weight of 576.44 g/mol. Its IUPAC name is (3S)-N-[5-[3-fluoro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)cyclohepta-1,3,6-trien-1-yl]-1-(4-fluorophenyl)pyrazol-3-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[5-[3-fluoro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)cyclohepta-1,3,6-trien-1-yl]-1-(4-fluorophenyl)pyrazol-3-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 144542907 |
| Molecular Formula | C25H20F8N4O3 |
| Molecular Weight | 576.44 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | (3S)-N-[5-[3-fluoro-6-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)cyclohepta-1,3,6-trien-1-yl]-1-(4-fluorophenyl)pyrazol-3-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C1C[C@H](C(=O)Nc2cc(C3=CC(F)=CCC(COC(C(F)(F)F)C(F)(F)F)=C3)n(-c3ccc(F)cc3)n2)CN1 |
| InChI | InChI=1S/C25H20F8N4O3/c26-16-3-5-18(6-4-16)37-19(10-20(36-37)35-22(39)15-9-21(38)34-11-15)14-7-13(1-2-17(27)8-14)12-40-23(24(28,29)30)25(31,32)33/h2-8,10,15,23H,1,9,11-12H2,(H,34,38)(H,35,36,39)/t15-/m0/s1 |
| InChIKey | OAYADXPZWRCBHT-HNNXBMFYSA-N |
| XLogP | 5.16 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.44 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |