About N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide
N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide (PubChem CID 14454296) has the molecular formula C16H12N4O2S
and a molecular weight of 324.37 g/mol. Its IUPAC name is N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide.
Molecular Properties
| Compound Name | N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide |
| PubChem CID | 14454296 |
| Molecular Formula | C16H12N4O2S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide |
| SMILES | O=C(Nc1n[nH]c(=S)n1C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12N4O2S/c21-13(11-7-3-1-4-8-11)17-15-18-19-16(23)20(15)14(22)12-9-5-2-6-10-12/h1-10H,(H,19,23)(H,17,18,21) |
| InChIKey | QQDVLOBKDOIASU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide?
The IUPAC name of N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide (CID 14454296) is N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide.
What is the SMILES notation for N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide?
The canonical SMILES for N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide is O=C(Nc1n[nH]c(=S)n1C(=O)c1ccccc1)c1ccccc1.
What is the InChIKey of N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide?
The InChIKey is QQDVLOBKDOIASU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N4O2S/c21-13(11-7-3-1-4-8-11)17-15-18-19-16(23)20(15)14(22)12-9-5-2-6-10-12/h1-10H,(H,19,23)(H,17,18,21).
What are the key properties of N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide?
N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide has a molecular weight of 324.37 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-benzoyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)benzamide is sourced from PubChem (CID 14454296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).