C19H17F6N3O — CID 144543027
3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]-2-phenyl-1,5-dihydropyrazol-5-amine (PubChem CID 144543027) has the molecular formula C19H17F6N3O and a molecular weight of 417.35 g/mol. Its IUPAC name is 3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]-2-phenyl-1,5-dihydropyrazol-5-amine.
| Compound Name | 3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]-2-phenyl-1,5-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 144543027 |
| Molecular Formula | C19H17F6N3O |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | 3-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)phenyl]-2-phenyl-1,5-dihydropyrazol-5-amine |
| SMILES | NC1C=C(c2cccc(COC(C(F)(F)F)C(F)(F)F)c2)N(c2ccccc2)N1 |
| InChI | InChI=1S/C19H17F6N3O/c20-18(21,22)17(19(23,24)25)29-11-12-5-4-6-13(9-12)15-10-16(26)27-28(15)14-7-2-1-3-8-14/h1-10,16-17,27H,11,26H2 |
| InChIKey | FAIWJQIAKRBSPX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |