About 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine
4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine (PubChem CID 144543254) has the molecular formula C12H16FN
and a molecular weight of 193.26 g/mol. Its IUPAC name is 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine.
Molecular Properties
| Compound Name | 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine |
| PubChem CID | 144543254 |
| Molecular Formula | C12H16FN |
| Molecular Weight | 193.26 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine |
| SMILES | FC12C=CC(C3CCNCC3)=CC1C2 |
| InChI | InChI=1S/C12H16FN/c13-12-4-1-10(7-11(12)8-12)9-2-5-14-6-3-9/h1,4,7,9,11,14H,2-3,5-6,8H2 |
| InChIKey | QKUDCAKIUJFKCD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine?
The IUPAC name of 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine (CID 144543254) is 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine.
What is the SMILES notation for 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine?
The canonical SMILES for 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine is FC12C=CC(C3CCNCC3)=CC1C2.
What is the InChIKey of 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine?
The InChIKey is QKUDCAKIUJFKCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FN/c13-12-4-1-10(7-11(12)8-12)9-2-5-14-6-3-9/h1,4,7,9,11,14H,2-3,5-6,8H2.
What are the key properties of 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine?
4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine has a molecular weight of 193.26 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(6-fluoro-3-bicyclo[4.1.0]hepta-2,4-dienyl)piperidine is sourced from PubChem (CID 144543254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).