About (Z)-2-cyano-N'-methylbut-2-enimidamide
(Z)-2-cyano-N'-methylbut-2-enimidamide (PubChem CID 144543745) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is (Z)-2-cyano-N'-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-2-cyano-N'-methylbut-2-enimidamide |
| PubChem CID | 144543745 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | (Z)-2-cyano-N'-methylbut-2-enimidamide |
| SMILES | C/C=C(C#N)\C(N)=N\C |
| InChI | InChI=1S/C6H9N3/c1-3-5(4-7)6(8)9-2/h3H,1-2H3,(H2,8,9)/b5-3- |
| InChIKey | BQLBEBKSMDTJOW-HYXAFXHYSA-N |
| XLogP | 0.44 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-cyano-N'-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-cyano-N'-methylbut-2-enimidamide?
The IUPAC name of (Z)-2-cyano-N'-methylbut-2-enimidamide (CID 144543745) is (Z)-2-cyano-N'-methylbut-2-enimidamide.
What is the SMILES notation for (Z)-2-cyano-N'-methylbut-2-enimidamide?
The canonical SMILES for (Z)-2-cyano-N'-methylbut-2-enimidamide is C/C=C(C#N)\C(N)=N\C.
What is the InChIKey of (Z)-2-cyano-N'-methylbut-2-enimidamide?
The InChIKey is BQLBEBKSMDTJOW-HYXAFXHYSA-N. The full InChI is InChI=1S/C6H9N3/c1-3-5(4-7)6(8)9-2/h3H,1-2H3,(H2,8,9)/b5-3-.
What are the key properties of (Z)-2-cyano-N'-methylbut-2-enimidamide?
(Z)-2-cyano-N'-methylbut-2-enimidamide has a molecular weight of 123.16 g/mol, XLogP of 0.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-cyano-N'-methylbut-2-enimidamide is sourced from PubChem (CID 144543745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).