C22H20F3N5O3 — CID 144544125
1-[7-[2,3,6-trifluoro-5-(propoxyamino)benzoyl]quinoxalin-2-yl]piperazin-2-one (PubChem CID 144544125) has the molecular formula C22H20F3N5O3 and a molecular weight of 459.43 g/mol. Its IUPAC name is 1-[7-[2,3,6-trifluoro-5-(propoxyamino)benzoyl]quinoxalin-2-yl]piperazin-2-one.
| Compound Name | 1-[7-[2,3,6-trifluoro-5-(propoxyamino)benzoyl]quinoxalin-2-yl]piperazin-2-one |
|---|---|
| PubChem CID | 144544125 |
| Molecular Formula | C22H20F3N5O3 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 1-[7-[2,3,6-trifluoro-5-(propoxyamino)benzoyl]quinoxalin-2-yl]piperazin-2-one |
| SMILES | CCCONc1cc(F)c(F)c(C(=O)c2ccc3ncc(N4CCNCC4=O)nc3c2)c1F |
| InChI | InChI=1S/C22H20F3N5O3/c1-2-7-33-29-16-9-13(23)20(24)19(21(16)25)22(32)12-3-4-14-15(8-12)28-17(10-27-14)30-6-5-26-11-18(30)31/h3-4,8-10,26,29H,2,5-7,11H2,1H3 |
| InChIKey | INPRHJIWWJBTHB-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|