About (7Z)-6,6-dimethyl-3H-diazocine
(7Z)-6,6-dimethyl-3H-diazocine (PubChem CID 144544150) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is (7Z)-6,6-dimethyl-3H-diazocine.
Molecular Properties
| Compound Name | (7Z)-6,6-dimethyl-3H-diazocine |
| PubChem CID | 144544150 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (7Z)-6,6-dimethyl-3H-diazocine |
| SMILES | CC1(C)C=CC/N=N\C=C/1 |
| InChI | InChI=1S/C8H12N2/c1-8(2)4-3-6-9-10-7-5-8/h3-5,7H,6H2,1-2H3/b4-3?,7-5-,10-9- |
| InChIKey | XWJBMLHMMOVNHE-UKEYZGQMSA-N |
| XLogP | 2.55 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7Z)-6,6-dimethyl-3H-diazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7Z)-6,6-dimethyl-3H-diazocine?
The IUPAC name of (7Z)-6,6-dimethyl-3H-diazocine (CID 144544150) is (7Z)-6,6-dimethyl-3H-diazocine.
What is the SMILES notation for (7Z)-6,6-dimethyl-3H-diazocine?
The canonical SMILES for (7Z)-6,6-dimethyl-3H-diazocine is CC1(C)C=CC/N=N\C=C/1.
What is the InChIKey of (7Z)-6,6-dimethyl-3H-diazocine?
The InChIKey is XWJBMLHMMOVNHE-UKEYZGQMSA-N. The full InChI is InChI=1S/C8H12N2/c1-8(2)4-3-6-9-10-7-5-8/h3-5,7H,6H2,1-2H3/b4-3?,7-5-,10-9-.
What are the key properties of (7Z)-6,6-dimethyl-3H-diazocine?
(7Z)-6,6-dimethyl-3H-diazocine has a molecular weight of 136.20 g/mol, XLogP of 2.55, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7Z)-6,6-dimethyl-3H-diazocine is sourced from PubChem (CID 144544150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).