C23H26N2O2 — CID 144544364
(1E,3Z,7E)-7-[1-(cyclohexa-1,5-dien-1-ylamino)-1-hydroxyethyl]-N-phenylcycloocta-1,3,7-triene-1-carboxamide (PubChem CID 144544364) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is (1E,3Z,7E)-7-[1-(cyclohexa-1,5-dien-1-ylamino)-1-hydroxyethyl]-N-phenylcycloocta-1,3,7-triene-1-carboxamide.
| Compound Name | (1E,3Z,7E)-7-[1-(cyclohexa-1,5-dien-1-ylamino)-1-hydroxyethyl]-N-phenylcycloocta-1,3,7-triene-1-carboxamide |
|---|---|
| PubChem CID | 144544364 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | (1E,3Z,7E)-7-[1-(cyclohexa-1,5-dien-1-ylamino)-1-hydroxyethyl]-N-phenylcycloocta-1,3,7-triene-1-carboxamide |
| SMILES | CC(O)(NC1=CCCC=C1)/C1=C/C(C(=O)Nc2ccccc2)=C\C=C/CC1 |
| InChI | InChI=1S/C23H26N2O2/c1-23(27,25-21-15-9-4-10-16-21)19-12-6-2-5-11-18(17-19)22(26)24-20-13-7-3-8-14-20/h2-3,5,7-9,11,13-17,25,27H,4,6,10,12H2,1H3,(H,24,26)/b5-2-,18-11+,19-17+ |
| InChIKey | ZBAXQZYDUYXUEY-WMPFHNISSA-N |
| XLogP | 4.36 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|