C21H34N2O — CID 144544482
1-[4-[4-(2,6-dimethylhept-5-enyl)piperazin-1-yl]cyclohexa-2,4-dien-1-yl]ethanone (PubChem CID 144544482) has the molecular formula C21H34N2O and a molecular weight of 330.52 g/mol. Its IUPAC name is 1-[4-[4-(2,6-dimethylhept-5-enyl)piperazin-1-yl]cyclohexa-2,4-dien-1-yl]ethanone.
| Compound Name | 1-[4-[4-(2,6-dimethylhept-5-enyl)piperazin-1-yl]cyclohexa-2,4-dien-1-yl]ethanone |
|---|---|
| PubChem CID | 144544482 |
| Molecular Formula | C21H34N2O |
| Molecular Weight | 330.52 g/mol |
| Exact Mass | 330.27 |
| IUPAC Name | 1-[4-[4-(2,6-dimethylhept-5-enyl)piperazin-1-yl]cyclohexa-2,4-dien-1-yl]ethanone |
| SMILES | CC(=O)C1C=CC(N2CCN(CC(C)CCC=C(C)C)CC2)=CC1 |
| InChI | InChI=1S/C21H34N2O/c1-17(2)6-5-7-18(3)16-22-12-14-23(15-13-22)21-10-8-20(9-11-21)19(4)24/h6,8,10-11,18,20H,5,7,9,12-16H2,1-4H3 |
| InChIKey | VRKBNTDSHISAHD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.52 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|