C15H17ClN2O3 — CID 144544881
(Z)-4-(3-chloro-4-propan-2-yloxyphenyl)-4-(methylideneamino)-2-methyliminobut-3-enoic acid (PubChem CID 144544881) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.77 g/mol. Its IUPAC name is (Z)-4-(3-chloro-4-propan-2-yloxyphenyl)-4-(methylideneamino)-2-methyliminobut-3-enoic acid.
| Compound Name | (Z)-4-(3-chloro-4-propan-2-yloxyphenyl)-4-(methylideneamino)-2-methyliminobut-3-enoic acid |
|---|---|
| PubChem CID | 144544881 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (Z)-4-(3-chloro-4-propan-2-yloxyphenyl)-4-(methylideneamino)-2-methyliminobut-3-enoic acid |
| SMILES | C=N/C(=C\C(=N\C)C(=O)O)c1ccc(OC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H17ClN2O3/c1-9(2)21-14-6-5-10(7-11(14)16)12(17-3)8-13(18-4)15(19)20/h5-9H,3H2,1-2,4H3,(H,19,20)/b12-8-,18-13- |
| InChIKey | WVCLILWYAYGIQB-XZYCYSTLSA-N |
| XLogP | 3.32 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|