C21H16N4O2 — CID 144544955
2-methoxy-6-methyl-4-(8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,8,10(17),11,14-octaen-9-yl)phenol (PubChem CID 144544955) has the molecular formula C21H16N4O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is 2-methoxy-6-methyl-4-(8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,8,10(17),11,14-octaen-9-yl)phenol.
| Compound Name | 2-methoxy-6-methyl-4-(8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,8,10(17),11,14-octaen-9-yl)phenol |
|---|---|
| PubChem CID | 144544955 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 2-methoxy-6-methyl-4-(8,13,14,16-tetrazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2,4,6,8,10(17),11,14-octaen-9-yl)phenol |
| SMILES | COc1cc(C2=Nc3ccccc3-c3ncnn4ccc2c34)cc(C)c1O |
| InChI | InChI=1S/C21H16N4O2/c1-12-9-13(10-17(27-2)21(12)26)18-15-7-8-25-20(15)19(22-11-23-25)14-5-3-4-6-16(14)24-18/h3-11,26H,1-2H3 |
| InChIKey | OEKJEWDHZGIRDA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |