C21H22N8O2 — CID 144545360
N-[5-[5-[(3E)-3-(aminohydrazinylidene)butyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 144545360) has the molecular formula C21H22N8O2 and a molecular weight of 418.46 g/mol. Its IUPAC name is N-[5-[5-[(3E)-3-(aminohydrazinylidene)butyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-[5-[5-[(3E)-3-(aminohydrazinylidene)butyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144545360 |
| Molecular Formula | C21H22N8O2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[5-[5-[(3E)-3-(aminohydrazinylidene)butyl]-1,2,4-oxadiazol-3-yl]-2-methylphenyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | C/C(CCc1nc(-c2ccc(C)c(NC(=O)c3cnc4ccccn34)c2)no1)=N\NN |
| InChI | InChI=1S/C21H22N8O2/c1-13-6-8-15(20-25-19(31-27-20)9-7-14(2)26-28-22)11-16(13)24-21(30)17-12-23-18-5-3-4-10-29(17)18/h3-6,8,10-12,28H,7,9,22H2,1-2H3,(H,24,30)/b26-14+ |
| InChIKey | MKBLWHOEDCOVFD-VULFUBBASA-N |
| XLogP | 2.72 |
| TPSA | 135.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|