C22H20N6O2 — CID 144545364
aniline;N-[2-methyl-5-(2H-oxadiazet-4-yl)phenyl]imidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 144545364) has the molecular formula C22H20N6O2 and a molecular weight of 400.44 g/mol. Its IUPAC name is aniline;N-[2-methyl-5-(2H-oxadiazet-4-yl)phenyl]imidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | aniline;N-[2-methyl-5-(2H-oxadiazet-4-yl)phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144545364 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | aniline;N-[2-methyl-5-(2H-oxadiazet-4-yl)phenyl]imidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccc(-c2n[nH]o2)cc1NC(=O)c1cnc2ccccn12.Nc1ccccc1 |
| InChI | InChI=1S/C16H13N5O2.C6H7N/c1-10-5-6-11(16-19-20-23-16)8-12(10)18-15(22)13-9-17-14-4-2-3-7-21(13)14;7-6-4-2-1-3-5-6/h2-9,20H,1H3,(H,18,22);1-5H,7H2 |
| InChIKey | XZXRUGASBTWNHZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 114.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|