About 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one
5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one (PubChem CID 144545870) has the molecular formula C19H22N2O
and a molecular weight of 294.40 g/mol. Its IUPAC name is 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one |
| PubChem CID | 144545870 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one |
| SMILES | CCc1cc(C)c(=O)[nH]c1-c1ccc2c(c1)c(C)c(C)n2C |
| InChI | InChI=1S/C19H22N2O/c1-6-14-9-11(2)19(22)20-18(14)15-7-8-17-16(10-15)12(3)13(4)21(17)5/h7-10H,6H2,1-5H3,(H,20,22) |
| InChIKey | WATIZNMOTSTPQM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one?
The IUPAC name of 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one (CID 144545870) is 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one.
What is the SMILES notation for 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one?
The canonical SMILES for 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one is CCc1cc(C)c(=O)[nH]c1-c1ccc2c(c1)c(C)c(C)n2C.
What is the InChIKey of 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one?
The InChIKey is WATIZNMOTSTPQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2O/c1-6-14-9-11(2)19(22)20-18(14)15-7-8-17-16(10-15)12(3)13(4)21(17)5/h7-10H,6H2,1-5H3,(H,20,22).
What are the key properties of 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one?
5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one has a molecular weight of 294.40 g/mol, XLogP of 4.02, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3-methyl-6-(1,2,3-trimethylindol-5-yl)-1H-pyridin-2-one is sourced from PubChem (CID 144545870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).