About (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane
(5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane (PubChem CID 144546063) has the molecular formula C12H18O2
and a molecular weight of 194.27 g/mol. Its IUPAC name is (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane.
Molecular Properties
| Compound Name | (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane |
| PubChem CID | 144546063 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane |
| SMILES | C/C=c1/cc(C)c(=O)o/c1=C/C.CC |
| InChI | InChI=1S/C10H12O2.C2H6/c1-4-8-6-7(3)10(11)12-9(8)5-2;1-2/h4-6H,1-3H3;1-2H3/b8-4-,9-5+; |
| InChIKey | XODGPDRMNIRGRV-UZKJHERWSA-N |
| XLogP | 1.58 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane?
The IUPAC name of (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane (CID 144546063) is (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane.
What is the SMILES notation for (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane?
The canonical SMILES for (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane is C/C=c1/cc(C)c(=O)o/c1=C/C.CC.
What is the InChIKey of (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane?
The InChIKey is XODGPDRMNIRGRV-UZKJHERWSA-N. The full InChI is InChI=1S/C10H12O2.C2H6/c1-4-8-6-7(3)10(11)12-9(8)5-2;1-2/h4-6H,1-3H3;1-2H3/b8-4-,9-5+;.
What are the key properties of (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane?
(5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane has a molecular weight of 194.27 g/mol, XLogP of 1.58, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z,6E)-5,6-di(ethylidene)-3-methylpyran-2-one;ethane is sourced from PubChem (CID 144546063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).