C21H23NO4 — CID 144546170
N-(3,4-dimethyl-2-oxochromen-6-yl)-2-methoxybenzamide;ethane (PubChem CID 144546170) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(3,4-dimethyl-2-oxochromen-6-yl)-2-methoxybenzamide;ethane.
| Compound Name | N-(3,4-dimethyl-2-oxochromen-6-yl)-2-methoxybenzamide;ethane |
|---|---|
| PubChem CID | 144546170 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-(3,4-dimethyl-2-oxochromen-6-yl)-2-methoxybenzamide;ethane |
| SMILES | CC.COc1ccccc1C(=O)Nc1ccc2oc(=O)c(C)c(C)c2c1 |
| InChI | InChI=1S/C19H17NO4.C2H6/c1-11-12(2)19(22)24-17-9-8-13(10-15(11)17)20-18(21)14-6-4-5-7-16(14)23-3;1-2/h4-10H,1-3H3,(H,20,21);1-2H3 |
| InChIKey | JQQMRHYBSINPPU-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|