About ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol
ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol (PubChem CID 144546746) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol.
Molecular Properties
| Compound Name | ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol |
| PubChem CID | 144546746 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol |
| SMILES | C=C(/C=C/O)NCCNC.C=CO.CC |
| InChI | InChI=1S/C7H14N2O.C2H4O.C2H6/c1-7(3-6-10)9-5-4-8-2;1-2-3;1-2/h3,6,8-10H,1,4-5H2,2H3;2-3H,1H2;1-2H3/b6-3+;; |
| InChIKey | BDZJBYLLMSNFOJ-RRHCXGJISA-N |
| XLogP | 2.09 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol?
The IUPAC name of ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol (CID 144546746) is ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol.
What is the SMILES notation for ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol?
The canonical SMILES for ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol is C=C(/C=C/O)NCCNC.C=CO.CC.
What is the InChIKey of ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol?
The InChIKey is BDZJBYLLMSNFOJ-RRHCXGJISA-N. The full InChI is InChI=1S/C7H14N2O.C2H4O.C2H6/c1-7(3-6-10)9-5-4-8-2;1-2-3;1-2/h3,6,8-10H,1,4-5H2,2H3;2-3H,1H2;1-2H3/b6-3+;;.
What are the key properties of ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol?
ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol has a molecular weight of 216.32 g/mol, XLogP of 2.09, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethenol;(1E)-3-[2-(methylamino)ethylamino]buta-1,3-dien-1-ol is sourced from PubChem (CID 144546746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).