C19H32O — CID 144546761
5-ethylspiro[3a,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3,5'-cycloheptyne];propane (PubChem CID 144546761) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 5-ethylspiro[3a,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3,5'-cycloheptyne];propane.
| Compound Name | 5-ethylspiro[3a,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3,5'-cycloheptyne];propane |
|---|---|
| PubChem CID | 144546761 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 5-ethylspiro[3a,4,5,6,7,7a-hexahydro-2H-1-benzofuran-3,5'-cycloheptyne];propane |
| SMILES | CCC.CCC1CCC2OCC3(CCC#CCC3)C2C1 |
| InChI | InChI=1S/C16H24O.C3H8/c1-2-13-7-8-15-14(11-13)16(12-17-15)9-5-3-4-6-10-16;1-3-2/h13-15H,2,5-12H2,1H3;3H2,1-2H3 |
| InChIKey | FWUNFDNWBCHJAX-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|