C30H56N2O4 — CID 14454716
bis(1,2,2,6,6-pentamethylpiperidin-3-yl) decanedioate (PubChem CID 14454716) has the molecular formula C30H56N2O4 and a molecular weight of 508.79 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-3-yl) decanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-3-yl) decanedioate |
|---|---|
| PubChem CID | 14454716 |
| Molecular Formula | C30H56N2O4 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.42 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-3-yl) decanedioate |
| SMILES | CN1C(C)(C)CCC(OC(=O)CCCCCCCCC(=O)OC2CCC(C)(C)N(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C30H56N2O4/c1-27(2)21-19-23(29(5,6)31(27)9)35-25(33)17-15-13-11-12-14-16-18-26(34)36-24-20-22-28(3,4)32(10)30(24,7)8/h23-24H,11-22H2,1-10H3 |
| InChIKey | SMISHRXKWQZCCQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|