About ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one
ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one (PubChem CID 144547296) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one |
| PubChem CID | 144547296 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one |
| SMILES | C/C=C1/CN(C)C(=O)O/C1=C/CC.CC |
| InChI | InChI=1S/C10H15NO2.C2H6/c1-4-6-9-8(5-2)7-11(3)10(12)13-9;1-2/h5-6H,4,7H2,1-3H3;1-2H3/b8-5-,9-6+; |
| InChIKey | MJKFFLBBLWHMGH-BJHRKZFFSA-N |
| XLogP | 3.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one?
The IUPAC name of ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one (CID 144547296) is ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one.
What is the SMILES notation for ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one?
The canonical SMILES for ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one is C/C=C1/CN(C)C(=O)O/C1=C/CC.CC.
What is the InChIKey of ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one?
The InChIKey is MJKFFLBBLWHMGH-BJHRKZFFSA-N. The full InChI is InChI=1S/C10H15NO2.C2H6/c1-4-6-9-8(5-2)7-11(3)10(12)13-9;1-2/h5-6H,4,7H2,1-3H3;1-2H3/b8-5-,9-6+;.
What are the key properties of ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one?
ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one has a molecular weight of 211.30 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5Z,6E)-5-ethylidene-3-methyl-6-propylidene-1,3-oxazinan-2-one is sourced from PubChem (CID 144547296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).