About 5,6-dihydro-1H-indole;ethane
5,6-dihydro-1H-indole;ethane (PubChem CID 144548243) has the molecular formula C10H15N
and a molecular weight of 149.24 g/mol. Its IUPAC name is 5,6-dihydro-1H-indole;ethane.
Molecular Properties
| Compound Name | 5,6-dihydro-1H-indole;ethane |
| PubChem CID | 144548243 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 5,6-dihydro-1H-indole;ethane |
| SMILES | C1=c2cc[nH]c2=CCC1.CC |
| InChI | InChI=1S/C8H9N.C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-2/h3-6,9H,1-2H2;1-2H3 |
| InChIKey | WMRWKXNVLVHQRH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,6-dihydro-1H-indole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1H-indole;ethane?
The IUPAC name of 5,6-dihydro-1H-indole;ethane (CID 144548243) is 5,6-dihydro-1H-indole;ethane.
What is the SMILES notation for 5,6-dihydro-1H-indole;ethane?
The canonical SMILES for 5,6-dihydro-1H-indole;ethane is C1=c2cc[nH]c2=CCC1.CC.
What is the InChIKey of 5,6-dihydro-1H-indole;ethane?
The InChIKey is WMRWKXNVLVHQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N.C2H6/c1-2-4-8-7(3-1)5-6-9-8;1-2/h3-6,9H,1-2H2;1-2H3.
What are the key properties of 5,6-dihydro-1H-indole;ethane?
5,6-dihydro-1H-indole;ethane has a molecular weight of 149.24 g/mol, XLogP of 1.40, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1H-indole;ethane is sourced from PubChem (CID 144548243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).