C14H11N3O — CID 144548899
5-dibenzofuran-2-yl-2,3-dihydro-1H-1,2,4-triazole (PubChem CID 144548899) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 5-dibenzofuran-2-yl-2,3-dihydro-1H-1,2,4-triazole.
| Compound Name | 5-dibenzofuran-2-yl-2,3-dihydro-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 144548899 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 5-dibenzofuran-2-yl-2,3-dihydro-1H-1,2,4-triazole |
| SMILES | c1ccc2c(c1)oc1ccc(C3=NCNN3)cc12 |
| InChI | InChI=1S/C14H11N3O/c1-2-4-12-10(3-1)11-7-9(5-6-13(11)18-12)14-15-8-16-17-14/h1-7,16H,8H2,(H,15,17) |
| InChIKey | BWBSNSIOLMUFCE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |