C27H26N2 — CID 144549145
N-cyclohepta-1,3,6-trien-1-yl-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-methylcarbazol-2-amine (PubChem CID 144549145) has the molecular formula C27H26N2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-cyclohepta-1,3,6-trien-1-yl-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-methylcarbazol-2-amine.
| Compound Name | N-cyclohepta-1,3,6-trien-1-yl-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-methylcarbazol-2-amine |
|---|---|
| PubChem CID | 144549145 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | N-cyclohepta-1,3,6-trien-1-yl-3-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-9-methylcarbazol-2-amine |
| SMILES | C=C(/C=C\C=C/C)c1cc2c3ccccc3n(C)c2cc1NC1=CC=CCC=C1 |
| InChI | InChI=1S/C27H26N2/c1-4-5-8-13-20(2)23-18-24-22-16-11-12-17-26(22)29(3)27(24)19-25(23)28-21-14-9-6-7-10-15-21/h4-6,8-19,28H,2,7H2,1,3H3/b5-4-,13-8- |
| InChIKey | KTMKBHXRNGXNMQ-NSMXULMMSA-N |
| XLogP | 7.29 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|