About 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene
4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene (PubChem CID 144549568) has the molecular formula C22H30
and a molecular weight of 294.48 g/mol. Its IUPAC name is 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene.
Molecular Properties
| Compound Name | 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene |
| PubChem CID | 144549568 |
| Molecular Formula | C22H30 |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene |
| SMILES | C=C.Cc1ccc(CCC(C)c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C20H26.C2H4/c1-14-6-9-19(12-17(14)4)10-7-16(3)20-11-8-15(2)18(5)13-20;1-2/h6,8-9,11-13,16H,7,10H2,1-5H3;1-2H2 |
| InChIKey | KSZGZAZJYFLDIJ-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene?
The IUPAC name of 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene (CID 144549568) is 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene.
What is the SMILES notation for 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene?
The canonical SMILES for 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene is C=C.Cc1ccc(CCC(C)c2ccc(C)c(C)c2)cc1C.
What is the InChIKey of 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene?
The InChIKey is KSZGZAZJYFLDIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26.C2H4/c1-14-6-9-19(12-17(14)4)10-7-16(3)20-11-8-15(2)18(5)13-20;1-2/h6,8-9,11-13,16H,7,10H2,1-5H3;1-2H2.
What are the key properties of 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene?
4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene has a molecular weight of 294.48 g/mol, XLogP of 6.46, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(3,4-dimethylphenyl)butan-2-yl]-1,2-dimethylbenzene;ethene is sourced from PubChem (CID 144549568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).