C22H26ClN3O4S — CID 144549743
1-[(1E,3S)-1-[2-[2-chloro-4-(cyclopropylmethoxy)phenoxy]-1,3-thiazol-5-yl]penta-1,4-dien-3-yl]-3-(2-methoxyethyl)urea (PubChem CID 144549743) has the molecular formula C22H26ClN3O4S and a molecular weight of 463.99 g/mol. Its IUPAC name is 1-[(1E,3S)-1-[2-[2-chloro-4-(cyclopropylmethoxy)phenoxy]-1,3-thiazol-5-yl]penta-1,4-dien-3-yl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[(1E,3S)-1-[2-[2-chloro-4-(cyclopropylmethoxy)phenoxy]-1,3-thiazol-5-yl]penta-1,4-dien-3-yl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 144549743 |
| Molecular Formula | C22H26ClN3O4S |
| Molecular Weight | 463.99 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | 1-[(1E,3S)-1-[2-[2-chloro-4-(cyclopropylmethoxy)phenoxy]-1,3-thiazol-5-yl]penta-1,4-dien-3-yl]-3-(2-methoxyethyl)urea |
| SMILES | C=C[C@@H](/C=C/c1cnc(Oc2ccc(OCC3CC3)cc2Cl)s1)NC(=O)NCCOC |
| InChI | InChI=1S/C22H26ClN3O4S/c1-3-16(26-21(27)24-10-11-28-2)6-8-18-13-25-22(31-18)30-20-9-7-17(12-19(20)23)29-14-15-4-5-15/h3,6-9,12-13,15-16H,1,4-5,10-11,14H2,2H3,(H2,24,26,27)/b8-6+/t16-/m0/s1 |
| InChIKey | NEWFTVZDQAHKKT-BVBGJJFLSA-N |
| XLogP | 4.89 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.99 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|