C20H21ClN2O3 — CID 144549755
N-[(1E,3S)-1-[6-(2-chloro-5-methoxyphenoxy)-3-pyridinyl]penta-1,4-dien-3-yl]propanamide (PubChem CID 144549755) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is N-[(1E,3S)-1-[6-(2-chloro-5-methoxyphenoxy)-3-pyridinyl]penta-1,4-dien-3-yl]propanamide.
| Compound Name | N-[(1E,3S)-1-[6-(2-chloro-5-methoxyphenoxy)-3-pyridinyl]penta-1,4-dien-3-yl]propanamide |
|---|---|
| PubChem CID | 144549755 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[(1E,3S)-1-[6-(2-chloro-5-methoxyphenoxy)-3-pyridinyl]penta-1,4-dien-3-yl]propanamide |
| SMILES | C=C[C@@H](/C=C/c1ccc(Oc2cc(OC)ccc2Cl)nc1)NC(=O)CC |
| InChI | InChI=1S/C20H21ClN2O3/c1-4-15(23-19(24)5-2)8-6-14-7-11-20(22-13-14)26-18-12-16(25-3)9-10-17(18)21/h4,6-13,15H,1,5H2,2-3H3,(H,23,24)/b8-6+/t15-/m0/s1 |
| InChIKey | ADCDRYNTXRDPJP-VFADXPBXSA-N |
| XLogP | 4.63 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|