C21H31NO — CID 144550017
(15R)-12,13,15-trimethyl-11-propyl-11-azatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5-trien-4-ol (PubChem CID 144550017) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is (15R)-12,13,15-trimethyl-11-propyl-11-azatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5-trien-4-ol.
| Compound Name | (15R)-12,13,15-trimethyl-11-propyl-11-azatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 144550017 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (15R)-12,13,15-trimethyl-11-propyl-11-azatetracyclo[7.7.0.01,13.02,7]hexadeca-2(7),3,5-trien-4-ol |
| SMILES | CCCN1CC2Cc3ccc(O)cc3C23C[C@@H](C)CC3(C)C1C |
| InChI | InChI=1S/C21H31NO/c1-5-8-22-13-17-9-16-6-7-18(23)10-19(16)21(17)12-14(2)11-20(21,4)15(22)3/h6-7,10,14-15,17,23H,5,8-9,11-13H2,1-4H3/t14-,15?,17?,20?,21?/m0/s1 |
| InChIKey | KPYLEHOSCGPZSQ-VUTWKYMGSA-N |
| XLogP | 4.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |