C49H52N2O10 — CID 144550293
N-[4-[6-[4-(1,3-dioxoisoindol-2-yl)butoxy]-8-hydroxy-2-methoxy-1,7-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxybutyl]-N-formyl-2-methylbenzamide (PubChem CID 144550293) has the molecular formula C49H52N2O10 and a molecular weight of 828.96 g/mol. Its IUPAC name is N-[4-[6-[4-(1,3-dioxoisoindol-2-yl)butoxy]-8-hydroxy-2-methoxy-1,7-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxybutyl]-N-formyl-2-methylbenzamide.
| Compound Name | N-[4-[6-[4-(1,3-dioxoisoindol-2-yl)butoxy]-8-hydroxy-2-methoxy-1,7-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxybutyl]-N-formyl-2-methylbenzamide |
|---|---|
| PubChem CID | 144550293 |
| Molecular Formula | C49H52N2O10 |
| Molecular Weight | 828.96 g/mol |
| Exact Mass | 828.36 |
| IUPAC Name | N-[4-[6-[4-(1,3-dioxoisoindol-2-yl)butoxy]-8-hydroxy-2-methoxy-1,7-bis(3-methylbut-2-enyl)-9-oxoxanthen-3-yl]oxybutyl]-N-formyl-2-methylbenzamide |
| SMILES | COc1c(OCCCCN(C=O)C(=O)c2ccccc2C)cc2oc3cc(OCCCCN4C(=O)c5ccccc5C4=O)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C49H52N2O10/c1-30(2)19-21-36-38(59-25-14-12-24-51-48(56)34-17-9-10-18-35(34)49(51)57)27-40-43(44(36)53)45(54)42-37(22-20-31(3)4)46(58-6)41(28-39(42)61-40)60-26-13-11-23-50(29-52)47(55)33-16-8-7-15-32(33)5/h7-10,15-20,27-29,53H,11-14,21-26H2,1-6H3 |
| InChIKey | QPPYBLFQENFEKH-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 152.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.96 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|