C12H25N3 — CID 144550341
ethane;5-ethyl-1-(2-methylprop-1-enyl)-1,2,4-triazole (PubChem CID 144550341) has the molecular formula C12H25N3 and a molecular weight of 211.35 g/mol. Its IUPAC name is ethane;5-ethyl-1-(2-methylprop-1-enyl)-1,2,4-triazole.
| Compound Name | ethane;5-ethyl-1-(2-methylprop-1-enyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 144550341 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | ethane;5-ethyl-1-(2-methylprop-1-enyl)-1,2,4-triazole |
| SMILES | CC.CC.CCc1ncnn1C=C(C)C |
| InChI | InChI=1S/C8H13N3.2C2H6/c1-4-8-9-6-10-11(8)5-7(2)3;2*1-2/h5-6H,4H2,1-3H3;2*1-2H3 |
| InChIKey | CDGYSZMGOHZNFS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |