C17H18O2 — CID 144550395
(4E)-4-ethenyl-5-methyl-1-(2-methylphenyl)hepta-4,6-diene-1,3-dione (PubChem CID 144550395) has the molecular formula C17H18O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is (4E)-4-ethenyl-5-methyl-1-(2-methylphenyl)hepta-4,6-diene-1,3-dione.
| Compound Name | (4E)-4-ethenyl-5-methyl-1-(2-methylphenyl)hepta-4,6-diene-1,3-dione |
|---|---|
| PubChem CID | 144550395 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | (4E)-4-ethenyl-5-methyl-1-(2-methylphenyl)hepta-4,6-diene-1,3-dione |
| SMILES | C=C/C(C)=C(\C=C)C(=O)CC(=O)c1ccccc1C |
| InChI | InChI=1S/C17H18O2/c1-5-12(3)14(6-2)16(18)11-17(19)15-10-8-7-9-13(15)4/h5-10H,1-2,11H2,3-4H3/b14-12+ |
| InChIKey | SHMMCMXNFWFCIX-WYMLVPIESA-N |
| XLogP | 3.83 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|