C13H25N3 — CID 144552148
ethane;2-[(2E,4E)-2-ethyl-4-methylhepta-2,4,6-trienyl]guanidine (PubChem CID 144552148) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is ethane;2-[(2E,4E)-2-ethyl-4-methylhepta-2,4,6-trienyl]guanidine.
| Compound Name | ethane;2-[(2E,4E)-2-ethyl-4-methylhepta-2,4,6-trienyl]guanidine |
|---|---|
| PubChem CID | 144552148 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | ethane;2-[(2E,4E)-2-ethyl-4-methylhepta-2,4,6-trienyl]guanidine |
| SMILES | C=C/C=C(C)/C=C(\CC)CN=C(N)N.CC |
| InChI | InChI=1S/C11H19N3.C2H6/c1-4-6-9(3)7-10(5-2)8-14-11(12)13;1-2/h4,6-7H,1,5,8H2,2-3H3,(H4,12,13,14);1-2H3/b9-6+,10-7+; |
| InChIKey | OCUIVHHOPZHVGB-BHSKDUGMSA-N |
| XLogP | 2.75 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|