C25H24F3N3O3 — CID 144552461
1-[1-[[(1R,2R)-4,6-difluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]methyl]-3-(2-fluoro-5-methoxyphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 144552461) has the molecular formula C25H24F3N3O3 and a molecular weight of 471.48 g/mol. Its IUPAC name is 1-[1-[[(1R,2R)-4,6-difluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]methyl]-3-(2-fluoro-5-methoxyphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 1-[1-[[(1R,2R)-4,6-difluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]methyl]-3-(2-fluoro-5-methoxyphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 144552461 |
| Molecular Formula | C25H24F3N3O3 |
| Molecular Weight | 471.48 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 1-[1-[[(1R,2R)-4,6-difluoro-2-hydroxy-2,3-dihydro-1H-inden-1-yl]methyl]-3-(2-fluoro-5-methoxyphenyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | COc1ccc(F)c(-c2nn(C[C@H]3c4cc(F)cc(F)c4C[C@H]3O)c3c2CN(C(C)=O)CC3)c1 |
| InChI | InChI=1S/C25H24F3N3O3/c1-13(32)30-6-5-23-20(11-30)25(18-9-15(34-2)3-4-21(18)27)29-31(23)12-19-16-7-14(26)8-22(28)17(16)10-24(19)33/h3-4,7-9,19,24,33H,5-6,10-12H2,1-2H3/t19-,24+/m0/s1 |
| InChIKey | OFKOVYXVKSUCHT-YADARESESA-N |
| XLogP | 3.58 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |