C16H14O6 — CID 144552861
2,4,8-trimethoxy-6-prop-2-enoylnaphthalene-1,5-dione (PubChem CID 144552861) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is 2,4,8-trimethoxy-6-prop-2-enoylnaphthalene-1,5-dione.
| Compound Name | 2,4,8-trimethoxy-6-prop-2-enoylnaphthalene-1,5-dione |
|---|---|
| PubChem CID | 144552861 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2,4,8-trimethoxy-6-prop-2-enoylnaphthalene-1,5-dione |
| SMILES | C=CC(=O)C1=CC(OC)=C2C(=O)C(OC)=CC(OC)=C2C1=O |
| InChI | InChI=1S/C16H14O6/c1-5-9(17)8-6-10(20-2)14-13(15(8)18)11(21-3)7-12(22-4)16(14)19/h5-7H,1H2,2-4H3 |
| InChIKey | JYXLFBDVENAQPZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|