C21H25ClN8O — CID 144553308
4-[1-(4-chlorophenyl)pyrrolo[2,3-c]pyridin-3-yl]-N-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]piperidine-1-carboxamide (PubChem CID 144553308) has the molecular formula C21H25ClN8O and a molecular weight of 440.94 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)pyrrolo[2,3-c]pyridin-3-yl]-N-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]piperidine-1-carboxamide.
| Compound Name | 4-[1-(4-chlorophenyl)pyrrolo[2,3-c]pyridin-3-yl]-N-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 144553308 |
| Molecular Formula | C21H25ClN8O |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | 4-[1-(4-chlorophenyl)pyrrolo[2,3-c]pyridin-3-yl]-N-[(2Z)-2-hydrazinyl-2-hydrazinylideneethyl]piperidine-1-carboxamide |
| SMILES | N/N=C(/CNC(=O)N1CCC(c2cn(-c3ccc(Cl)cc3)c3cnccc23)CC1)NN |
| InChI | InChI=1S/C21H25ClN8O/c22-15-1-3-16(4-2-15)30-13-18(17-5-8-25-11-19(17)30)14-6-9-29(10-7-14)21(31)26-12-20(27-23)28-24/h1-5,8,11,13-14H,6-7,9-10,12,23-24H2,(H,26,31)(H,27,28) |
| InChIKey | FEXASQVTTJXIRX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 126.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|