About (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane
(2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane (PubChem CID 144553353) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane.
Molecular Properties
| Compound Name | (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane |
| PubChem CID | 144553353 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane |
| SMILES | C=C/C(C=O)=C\C(=C/C)CN.CC.CC |
| InChI | InChI=1S/C9H13NO.2C2H6/c1-3-8(6-10)5-9(4-2)7-11;2*1-2/h3-5,7H,2,6,10H2,1H3;2*1-2H3/b8-3+,9-5+;; |
| InChIKey | QZUKWVDQYSHDIW-NSBZQTBVSA-N |
| XLogP | 3.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane?
The IUPAC name of (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane (CID 144553353) is (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane.
What is the SMILES notation for (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane?
The canonical SMILES for (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane is C=C/C(C=O)=C\C(=C/C)CN.CC.CC.
What is the InChIKey of (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane?
The InChIKey is QZUKWVDQYSHDIW-NSBZQTBVSA-N. The full InChI is InChI=1S/C9H13NO.2C2H6/c1-3-8(6-10)5-9(4-2)7-11;2*1-2/h3-5,7H,2,6,10H2,1H3;2*1-2H3/b8-3+,9-5+;;.
What are the key properties of (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane?
(2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane has a molecular weight of 211.35 g/mol, XLogP of 3.26, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-4-(aminomethyl)-2-ethenylhexa-2,4-dienal;ethane is sourced from PubChem (CID 144553353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).