About N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide
N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide (PubChem CID 144553644) has the molecular formula C24H32N2
and a molecular weight of 348.53 g/mol. Its IUPAC name is N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide.
Molecular Properties
| Compound Name | N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide |
| PubChem CID | 144553644 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide |
| SMILES | C=CN(/C(=N/C)c1ccccc1C(C)(C)CC)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H32N2/c1-9-24(6,7)21-14-12-11-13-20(21)23(25-8)26(10-2)22-18(4)15-17(3)16-19(22)5/h10-16H,2,9H2,1,3-8H3/b25-23+ |
| InChIKey | MQTZMBGYHWFQSN-WJTDDFOZSA-N |
| XLogP | 6.33 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide?
The IUPAC name of N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide (CID 144553644) is N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide.
What is the SMILES notation for N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide?
The canonical SMILES for N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide is C=CN(/C(=N/C)c1ccccc1C(C)(C)CC)c1c(C)cc(C)cc1C.
What is the InChIKey of N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide?
The InChIKey is MQTZMBGYHWFQSN-WJTDDFOZSA-N. The full InChI is InChI=1S/C24H32N2/c1-9-24(6,7)21-14-12-11-13-20(21)23(25-8)26(10-2)22-18(4)15-17(3)16-19(22)5/h10-16H,2,9H2,1,3-8H3/b25-23+.
What are the key properties of N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide?
N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide has a molecular weight of 348.53 g/mol, XLogP of 6.33, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-N'-methyl-2-(2-methylbutan-2-yl)-N-(2,4,6-trimethylphenyl)benzenecarboximidamide is sourced from PubChem (CID 144553644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).