About (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile
(4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile (PubChem CID 144554325) has the molecular formula C10H12ClNO
and a molecular weight of 197.66 g/mol. Its IUPAC name is (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile.
Molecular Properties
| Compound Name | (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile |
| PubChem CID | 144554325 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile |
| SMILES | C=C(OC)/C(C)=C(/Cl)C(=C)CC#N |
| InChI | InChI=1S/C10H12ClNO/c1-7(5-6-12)10(11)8(2)9(3)13-4/h1,3,5H2,2,4H3/b10-8+ |
| InChIKey | QVJNBHIMKCFGSB-CSKARUKUSA-N |
| XLogP | 3.13 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile?
The IUPAC name of (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile (CID 144554325) is (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile.
What is the SMILES notation for (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile?
The canonical SMILES for (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile is C=C(OC)/C(C)=C(/Cl)C(=C)CC#N.
What is the InChIKey of (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile?
The InChIKey is QVJNBHIMKCFGSB-CSKARUKUSA-N. The full InChI is InChI=1S/C10H12ClNO/c1-7(5-6-12)10(11)8(2)9(3)13-4/h1,3,5H2,2,4H3/b10-8+.
What are the key properties of (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile?
(4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile has a molecular weight of 197.66 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-chloro-6-methoxy-5-methyl-3-methylidenehepta-4,6-dienenitrile is sourced from PubChem (CID 144554325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).