C16H27N3O2 — CID 144554369
(Z)-5-amino-2-(1H-imidazol-5-ylmethyl)pent-2-enoic acid;methylcyclohexane (PubChem CID 144554369) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is (Z)-5-amino-2-(1H-imidazol-5-ylmethyl)pent-2-enoic acid;methylcyclohexane.
| Compound Name | (Z)-5-amino-2-(1H-imidazol-5-ylmethyl)pent-2-enoic acid;methylcyclohexane |
|---|---|
| PubChem CID | 144554369 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (Z)-5-amino-2-(1H-imidazol-5-ylmethyl)pent-2-enoic acid;methylcyclohexane |
| SMILES | CC1CCCCC1.NCC/C=C(/Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C9H13N3O2.C7H14/c10-3-1-2-7(9(13)14)4-8-5-11-6-12-8;1-7-5-3-2-4-6-7/h2,5-6H,1,3-4,10H2,(H,11,12)(H,13,14);7H,2-6H2,1H3/b7-2-; |
| InChIKey | QIPFZQVWULOPRS-YMWUIOJXSA-N |
| XLogP | 2.90 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|