About (2-methylsulfanylphenyl) hypoiodite
(2-methylsulfanylphenyl) hypoiodite (PubChem CID 144554638) has the molecular formula C7H7IOS
and a molecular weight of 266.10 g/mol. Its IUPAC name is (2-methylsulfanylphenyl) hypoiodite.
Molecular Properties
| Compound Name | (2-methylsulfanylphenyl) hypoiodite |
| PubChem CID | 144554638 |
| Molecular Formula | C7H7IOS |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 265.93 |
| IUPAC Name | (2-methylsulfanylphenyl) hypoiodite |
| SMILES | CSc1ccccc1OI |
| InChI | InChI=1S/C7H7IOS/c1-10-7-5-3-2-4-6(7)9-8/h2-5H,1H3 |
| InChIKey | GGCDWYKXABRZAV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2-methylsulfanylphenyl) hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylsulfanylphenyl) hypoiodite?
The IUPAC name of (2-methylsulfanylphenyl) hypoiodite (CID 144554638) is (2-methylsulfanylphenyl) hypoiodite.
What is the SMILES notation for (2-methylsulfanylphenyl) hypoiodite?
The canonical SMILES for (2-methylsulfanylphenyl) hypoiodite is CSc1ccccc1OI.
What is the InChIKey of (2-methylsulfanylphenyl) hypoiodite?
The InChIKey is GGCDWYKXABRZAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7IOS/c1-10-7-5-3-2-4-6(7)9-8/h2-5H,1H3.
What are the key properties of (2-methylsulfanylphenyl) hypoiodite?
(2-methylsulfanylphenyl) hypoiodite has a molecular weight of 266.10 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylsulfanylphenyl) hypoiodite is sourced from PubChem (CID 144554638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).