C23H30O5 — CID 144555049
3-(2-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl)propanoic acid;4-methyloct-1-en-6-yn-3-ol (PubChem CID 144555049) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is 3-(2-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl)propanoic acid;4-methyloct-1-en-6-yn-3-ol.
| Compound Name | 3-(2-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl)propanoic acid;4-methyloct-1-en-6-yn-3-ol |
|---|---|
| PubChem CID | 144555049 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 3-(2-hydroxy-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl)propanoic acid;4-methyloct-1-en-6-yn-3-ol |
| SMILES | C=CC(O)C(C)CC#CC.O=C(O)CCc1cccc2c1OC1CC(O)CC21 |
| InChI | InChI=1S/C14H16O4.C9H14O/c15-9-6-11-10-3-1-2-8(4-5-13(16)17)14(10)18-12(11)7-9;1-4-6-7-8(3)9(10)5-2/h1-3,9,11-12,15H,4-7H2,(H,16,17);5,8-10H,2,7H2,1,3H3 |
| InChIKey | DYVTYBAGYMWLNH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|