C19H32O4 — CID 144555066
cyclopentylmethanol;ethane;methyl 4-(2-hydroxyphenyl)butanoate (PubChem CID 144555066) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is cyclopentylmethanol;ethane;methyl 4-(2-hydroxyphenyl)butanoate.
| Compound Name | cyclopentylmethanol;ethane;methyl 4-(2-hydroxyphenyl)butanoate |
|---|---|
| PubChem CID | 144555066 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | cyclopentylmethanol;ethane;methyl 4-(2-hydroxyphenyl)butanoate |
| SMILES | CC.COC(=O)CCCc1ccccc1O.OCC1CCCC1 |
| InChI | InChI=1S/C11H14O3.C6H12O.C2H6/c1-14-11(13)8-4-6-9-5-2-3-7-10(9)12;7-5-6-3-1-2-4-6;1-2/h2-3,5,7,12H,4,6,8H2,1H3;6-7H,1-5H2;1-2H3 |
| InChIKey | GIMBGYGQWSEQAH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |