About propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate
propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate (PubChem CID 144555088) has the molecular formula C14H26N2O3
and a molecular weight of 270.37 g/mol. Its IUPAC name is propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate.
Molecular Properties
| Compound Name | propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate |
| PubChem CID | 144555088 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate |
| SMILES | C/C=C\C(=C/CC)COC(=O)NCC(N)=O.CCC |
| InChI | InChI=1S/C11H18N2O3.C3H8/c1-3-5-9(6-4-2)8-16-11(15)13-7-10(12)14;1-3-2/h3,5-6H,4,7-8H2,1-2H3,(H2,12,14)(H,13,15);3H2,1-2H3/b5-3-,9-6+; |
| InChIKey | NYZZBUBILSSURV-XRVNEYCPSA-N |
| XLogP | 2.53 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate?
The IUPAC name of propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate (CID 144555088) is propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate.
What is the SMILES notation for propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate?
The canonical SMILES for propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate is C/C=C\C(=C/CC)COC(=O)NCC(N)=O.CCC.
What is the InChIKey of propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate?
The InChIKey is NYZZBUBILSSURV-XRVNEYCPSA-N. The full InChI is InChI=1S/C11H18N2O3.C3H8/c1-3-5-9(6-4-2)8-16-11(15)13-7-10(12)14;1-3-2/h3,5-6H,4,7-8H2,1-2H3,(H2,12,14)(H,13,15);3H2,1-2H3/b5-3-,9-6+;.
What are the key properties of propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate?
propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate has a molecular weight of 270.37 g/mol, XLogP of 2.53, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propane;[(E)-2-[(Z)-prop-1-enyl]pent-2-enyl] N-(2-amino-2-oxoethyl)carbamate is sourced from PubChem (CID 144555088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).