About 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine
3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine (PubChem CID 144555247) has the molecular formula C11H13BrF2N2
and a molecular weight of 291.14 g/mol. Its IUPAC name is 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine.
Molecular Properties
| Compound Name | 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine |
| PubChem CID | 144555247 |
| Molecular Formula | C11H13BrF2N2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine |
| SMILES | FC1(F)CCN(CCc2cncc(Br)c2)C1 |
| InChI | InChI=1S/C11H13BrF2N2/c12-10-5-9(6-15-7-10)1-3-16-4-2-11(13,14)8-16/h5-7H,1-4,8H2 |
| InChIKey | QSBGYFAHMRFIDY-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine?
The IUPAC name of 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine (CID 144555247) is 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine.
What is the SMILES notation for 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine?
The canonical SMILES for 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine is FC1(F)CCN(CCc2cncc(Br)c2)C1.
What is the InChIKey of 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine?
The InChIKey is QSBGYFAHMRFIDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrF2N2/c12-10-5-9(6-15-7-10)1-3-16-4-2-11(13,14)8-16/h5-7H,1-4,8H2.
What are the key properties of 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine?
3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine has a molecular weight of 291.14 g/mol, XLogP of 2.73, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-5-[2-(3,3-difluoropyrrolidin-1-yl)ethyl]pyridine is sourced from PubChem (CID 144555247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).