C21H26F3N5O2 — CID 144556167
3-(4-methylanilino)-1-[(1S,2S,4S)-2-methyl-4-(2,2,2-trifluoroethylcarbamoyl)cyclohexyl]pyrazole-4-carboxamide (PubChem CID 144556167) has the molecular formula C21H26F3N5O2 and a molecular weight of 437.47 g/mol. Its IUPAC name is 3-(4-methylanilino)-1-[(1S,2S,4S)-2-methyl-4-(2,2,2-trifluoroethylcarbamoyl)cyclohexyl]pyrazole-4-carboxamide.
| Compound Name | 3-(4-methylanilino)-1-[(1S,2S,4S)-2-methyl-4-(2,2,2-trifluoroethylcarbamoyl)cyclohexyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144556167 |
| Molecular Formula | C21H26F3N5O2 |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-(4-methylanilino)-1-[(1S,2S,4S)-2-methyl-4-(2,2,2-trifluoroethylcarbamoyl)cyclohexyl]pyrazole-4-carboxamide |
| SMILES | Cc1ccc(Nc2nn([C@H]3CC[C@H](C(=O)NCC(F)(F)F)C[C@@H]3C)cc2C(N)=O)cc1 |
| InChI | InChI=1S/C21H26F3N5O2/c1-12-3-6-15(7-4-12)27-19-16(18(25)30)10-29(28-19)17-8-5-14(9-13(17)2)20(31)26-11-21(22,23)24/h3-4,6-7,10,13-14,17H,5,8-9,11H2,1-2H3,(H2,25,30)(H,26,31)(H,27,28)/t13-,14-,17-/m0/s1 |
| InChIKey | KRITVTFDFJVWON-ZQIUZPCESA-N |
| XLogP | 3.69 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |