C10H5F2NO4 — CID 14455621
6,7-difluoro-8-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 14455621) has the molecular formula C10H5F2NO4 and a molecular weight of 241.15 g/mol. Its IUPAC name is 6,7-difluoro-8-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6,7-difluoro-8-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 14455621 |
| Molecular Formula | C10H5F2NO4 |
| Molecular Weight | 241.15 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 6,7-difluoro-8-hydroxy-4-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(O)c1c[nH]c2c(O)c(F)c(F)cc2c1=O |
| InChI | InChI=1S/C10H5F2NO4/c11-5-1-3-7(9(15)6(5)12)13-2-4(8(3)14)10(16)17/h1-2,15H,(H,13,14)(H,16,17) |
| InChIKey | GNSBGBAAFPFTQK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |