C10H8F2N4O — CID 144556345
1-(3,4-difluoroanilino)pyrazole-4-carboxamide (PubChem CID 144556345) has the molecular formula C10H8F2N4O and a molecular weight of 238.20 g/mol. Its IUPAC name is 1-(3,4-difluoroanilino)pyrazole-4-carboxamide.
| Compound Name | 1-(3,4-difluoroanilino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 144556345 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-(3,4-difluoroanilino)pyrazole-4-carboxamide |
| SMILES | NC(=O)c1cnn(Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C10H8F2N4O/c11-8-2-1-7(3-9(8)12)15-16-5-6(4-14-16)10(13)17/h1-5,15H,(H2,13,17) |
| InChIKey | KSTDWFZPWSHBLI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |