About methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate
methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate (PubChem CID 144556873) has the molecular formula C22H19FO5
and a molecular weight of 382.39 g/mol. Its IUPAC name is methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate |
| PubChem CID | 144556873 |
| Molecular Formula | C22H19FO5 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate |
| SMILES | C=C/C=C(\C(=C)F)c1cc2c(cc1C(=O)OC)-c1cc(OC)c(O)cc1CO2 |
| InChI | InChI=1S/C22H19FO5/c1-5-6-14(12(2)23)16-10-20-17(8-18(16)22(25)27-4)15-9-21(26-3)19(24)7-13(15)11-28-20/h5-10,24H,1-2,11H2,3-4H3/b14-6+ |
| InChIKey | PDOHPTAVTQSWDC-MKMNVTDBSA-N |
| XLogP | 4.80 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate?
The IUPAC name of methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate (CID 144556873) is methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate.
What is the SMILES notation for methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate?
The canonical SMILES for methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate is C=C/C=C(\C(=C)F)c1cc2c(cc1C(=O)OC)-c1cc(OC)c(O)cc1CO2.
What is the InChIKey of methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate?
The InChIKey is PDOHPTAVTQSWDC-MKMNVTDBSA-N. The full InChI is InChI=1S/C22H19FO5/c1-5-6-14(12(2)23)16-10-20-17(8-18(16)22(25)27-4)15-9-21(26-3)19(24)7-13(15)11-28-20/h5-10,24H,1-2,11H2,3-4H3/b14-6+.
What are the key properties of methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate?
methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate has a molecular weight of 382.39 g/mol, XLogP of 4.80, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(3Z)-2-fluorohexa-1,3,5-trien-3-yl]-8-hydroxy-9-methoxy-6H-benzo[c]chromene-2-carboxylate is sourced from PubChem (CID 144556873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).