About 2-(3-bromophenyl)propan-2-ol;ethanol
2-(3-bromophenyl)propan-2-ol;ethanol (PubChem CID 144557078) has the molecular formula C11H17BrO2
and a molecular weight of 261.16 g/mol. Its IUPAC name is 2-(3-bromophenyl)propan-2-ol;ethanol.
Molecular Properties
| Compound Name | 2-(3-bromophenyl)propan-2-ol;ethanol |
| PubChem CID | 144557078 |
| Molecular Formula | C11H17BrO2 |
| Molecular Weight | 261.16 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-(3-bromophenyl)propan-2-ol;ethanol |
| SMILES | CC(C)(O)c1cccc(Br)c1.CCO |
| InChI | InChI=1S/C9H11BrO.C2H6O/c1-9(2,11)7-4-3-5-8(10)6-7;1-2-3/h3-6,11H,1-2H3;3H,2H2,1H3 |
| InChIKey | WDRZRPHOPUJDEJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.16 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-bromophenyl)propan-2-ol;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromophenyl)propan-2-ol;ethanol?
The IUPAC name of 2-(3-bromophenyl)propan-2-ol;ethanol (CID 144557078) is 2-(3-bromophenyl)propan-2-ol;ethanol.
What is the SMILES notation for 2-(3-bromophenyl)propan-2-ol;ethanol?
The canonical SMILES for 2-(3-bromophenyl)propan-2-ol;ethanol is CC(C)(O)c1cccc(Br)c1.CCO.
What is the InChIKey of 2-(3-bromophenyl)propan-2-ol;ethanol?
The InChIKey is WDRZRPHOPUJDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BrO.C2H6O/c1-9(2,11)7-4-3-5-8(10)6-7;1-2-3/h3-6,11H,1-2H3;3H,2H2,1H3.
What are the key properties of 2-(3-bromophenyl)propan-2-ol;ethanol?
2-(3-bromophenyl)propan-2-ol;ethanol has a molecular weight of 261.16 g/mol, XLogP of 2.68, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromophenyl)propan-2-ol;ethanol is sourced from PubChem (CID 144557078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).